C21H21NO2 — CID 7365950
2-(benzyliminomethyl)-5-(4-methylphenyl)cyclohexane-1,3-dione (PubChem CID 7365950) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-(benzyliminomethyl)-5-(4-methylphenyl)cyclohexane-1,3-dione.
| Compound Name | 2-(benzyliminomethyl)-5-(4-methylphenyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 7365950 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 2-(benzyliminomethyl)-5-(4-methylphenyl)cyclohexane-1,3-dione |
| SMILES | Cc1ccc(C2CC(=O)C(/C=N/Cc3ccccc3)C(=O)C2)cc1 |
| InChI | InChI=1S/C21H21NO2/c1-15-7-9-17(10-8-15)18-11-20(23)19(21(24)12-18)14-22-13-16-5-3-2-4-6-16/h2-10,14,18-19H,11-13H2,1H3/b22-14+ |
| InChIKey | VGBWTZKNTCVQQF-HYARGMPZSA-N |
| XLogP | 3.90 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|