C20H20N2O2 — CID 7313044
5-phenyl-2-(2-pyridin-2-ylethyliminomethyl)cyclohexane-1,3-dione (PubChem CID 7313044) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 5-phenyl-2-(2-pyridin-2-ylethyliminomethyl)cyclohexane-1,3-dione.
| Compound Name | 5-phenyl-2-(2-pyridin-2-ylethyliminomethyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 7313044 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 5-phenyl-2-(2-pyridin-2-ylethyliminomethyl)cyclohexane-1,3-dione |
| SMILES | O=C1CC(c2ccccc2)CC(=O)C1/C=N/CCc1ccccn1 |
| InChI | InChI=1S/C20H20N2O2/c23-19-12-16(15-6-2-1-3-7-15)13-20(24)18(19)14-21-11-9-17-8-4-5-10-22-17/h1-8,10,14,16,18H,9,11-13H2/b21-14+ |
| InChIKey | IYTARHQDFUIFLS-KGENOOAVSA-N |
| XLogP | 3.03 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|