C20H20N4 — CID 139182392
1-N,2-N-bis(2-pyridin-2-ylethyl)cyclohexa-3,5-diene-1,2-diimine (PubChem CID 139182392) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is 1-N,2-N-bis(2-pyridin-2-ylethyl)cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 1-N,2-N-bis(2-pyridin-2-ylethyl)cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 139182392 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 1-N,2-N-bis(2-pyridin-2-ylethyl)cyclohexa-3,5-diene-1,2-diimine |
| SMILES | C1=CC(=N\CCc2ccccn2)/C(=N/CCc2ccccn2)C=C1 |
| InChI | InChI=1S/C20H20N4/c1-2-10-20(24-16-12-18-8-4-6-14-22-18)19(9-1)23-15-11-17-7-3-5-13-21-17/h1-10,13-14H,11-12,15-16H2/b23-19+,24-20+ |
| InChIKey | OYZNWOLCEICDKI-BLVCXSLXSA-N |
| XLogP | 3.27 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|