C21H28N2O4 — CID 135408449
3-hydroxy-5-(4-methoxyphenyl)-2-(3-morpholin-4-ylpropyliminomethyl)cyclohex-2-en-1-one (PubChem CID 135408449) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 3-hydroxy-5-(4-methoxyphenyl)-2-(3-morpholin-4-ylpropyliminomethyl)cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-5-(4-methoxyphenyl)-2-(3-morpholin-4-ylpropyliminomethyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135408449 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 3-hydroxy-5-(4-methoxyphenyl)-2-(3-morpholin-4-ylpropyliminomethyl)cyclohex-2-en-1-one |
| SMILES | COc1ccc(C2CC(=O)C(/C=N/CCCN3CCOCC3)=C(O)C2)cc1 |
| InChI | InChI=1S/C21H28N2O4/c1-26-18-5-3-16(4-6-18)17-13-20(24)19(21(25)14-17)15-22-7-2-8-23-9-11-27-12-10-23/h3-6,15,17,24H,2,7-14H2,1H3/b22-15+ |
| InChIKey | GOVQUDUDZRTBFL-PXLXIMEGSA-N |
| XLogP | 2.75 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|