C21H21NO3 — CID 135442021
3-hydroxy-5-(4-methoxyphenyl)-2-[(4-methylphenyl)iminomethyl]cyclohex-2-en-1-one (PubChem CID 135442021) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 3-hydroxy-5-(4-methoxyphenyl)-2-[(4-methylphenyl)iminomethyl]cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-5-(4-methoxyphenyl)-2-[(4-methylphenyl)iminomethyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135442021 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-hydroxy-5-(4-methoxyphenyl)-2-[(4-methylphenyl)iminomethyl]cyclohex-2-en-1-one |
| SMILES | COc1ccc(C2CC(=O)C(/C=N/c3ccc(C)cc3)=C(O)C2)cc1 |
| InChI | InChI=1S/C21H21NO3/c1-14-3-7-17(8-4-14)22-13-19-20(23)11-16(12-21(19)24)15-5-9-18(25-2)10-6-15/h3-10,13,16,23H,11-12H2,1-2H3/b22-13+ |
| InChIKey | XMFVBYHFQXYQDQ-LPYMAVHISA-N |
| XLogP | 4.66 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|