C24H23N3O3 — CID 135400064
3-hydroxy-5-(4-methoxyphenyl)-2-[(5-methyl-4-phenyl-1H-pyrazol-3-yl)iminomethyl]cyclohex-2-en-1-one (PubChem CID 135400064) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 3-hydroxy-5-(4-methoxyphenyl)-2-[(5-methyl-4-phenyl-1H-pyrazol-3-yl)iminomethyl]cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-5-(4-methoxyphenyl)-2-[(5-methyl-4-phenyl-1H-pyrazol-3-yl)iminomethyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135400064 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 3-hydroxy-5-(4-methoxyphenyl)-2-[(5-methyl-4-phenyl-1H-pyrazol-3-yl)iminomethyl]cyclohex-2-en-1-one |
| SMILES | COc1ccc(C2CC(=O)C(/C=N/c3n[nH]c(C)c3-c3ccccc3)=C(O)C2)cc1 |
| InChI | InChI=1S/C24H23N3O3/c1-15-23(17-6-4-3-5-7-17)24(27-26-15)25-14-20-21(28)12-18(13-22(20)29)16-8-10-19(30-2)11-9-16/h3-11,14,18,28H,12-13H2,1-2H3,(H,26,27)/b25-14+ |
| InChIKey | AOCYWXZCQVBYEU-AFUMVMLFSA-N |
| XLogP | 5.05 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|