C26H27N3O5 — CID 135490332
3-hydroxy-2-[(5-methyl-4-phenyl-1H-pyrazol-3-yl)iminomethyl]-5-(3,4,5-trimethoxyphenyl)cyclohex-2-en-1-one (PubChem CID 135490332) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is 3-hydroxy-2-[(5-methyl-4-phenyl-1H-pyrazol-3-yl)iminomethyl]-5-(3,4,5-trimethoxyphenyl)cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-2-[(5-methyl-4-phenyl-1H-pyrazol-3-yl)iminomethyl]-5-(3,4,5-trimethoxyphenyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135490332 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 3-hydroxy-2-[(5-methyl-4-phenyl-1H-pyrazol-3-yl)iminomethyl]-5-(3,4,5-trimethoxyphenyl)cyclohex-2-en-1-one |
| SMILES | COc1cc(C2CC(=O)C(/C=N/c3n[nH]c(C)c3-c3ccccc3)=C(O)C2)cc(OC)c1OC |
| InChI | InChI=1S/C26H27N3O5/c1-15-24(16-8-6-5-7-9-16)26(29-28-15)27-14-19-20(30)10-17(11-21(19)31)18-12-22(32-2)25(34-4)23(13-18)33-3/h5-9,12-14,17,30H,10-11H2,1-4H3,(H,28,29)/b27-14+ |
| InChIKey | DGLIZKUUZYVZPB-MZJWZYIUSA-N |
| XLogP | 5.07 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|