C23H20ClN3O2 — CID 135456293
5-(4-chlorophenyl)-3-hydroxy-2-[(5-methyl-4-phenyl-1H-pyrazol-3-yl)iminomethyl]cyclohex-2-en-1-one (PubChem CID 135456293) has the molecular formula C23H20ClN3O2 and a molecular weight of 405.89 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-hydroxy-2-[(5-methyl-4-phenyl-1H-pyrazol-3-yl)iminomethyl]cyclohex-2-en-1-one.
| Compound Name | 5-(4-chlorophenyl)-3-hydroxy-2-[(5-methyl-4-phenyl-1H-pyrazol-3-yl)iminomethyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135456293 |
| Molecular Formula | C23H20ClN3O2 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 5-(4-chlorophenyl)-3-hydroxy-2-[(5-methyl-4-phenyl-1H-pyrazol-3-yl)iminomethyl]cyclohex-2-en-1-one |
| SMILES | Cc1[nH]nc(/N=C/C2=C(O)CC(c3ccc(Cl)cc3)CC2=O)c1-c1ccccc1 |
| InChI | InChI=1S/C23H20ClN3O2/c1-14-22(16-5-3-2-4-6-16)23(27-26-14)25-13-19-20(28)11-17(12-21(19)29)15-7-9-18(24)10-8-15/h2-10,13,17,28H,11-12H2,1H3,(H,26,27)/b25-13+ |
| InChIKey | SEHPYXGRPNSJTO-DHRITJCHSA-N |
| XLogP | 5.70 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|