C23H25NO5 — CID 135447546
3-hydroxy-5-phenyl-2-[(3,4,5-trimethoxyphenyl)methyliminomethyl]cyclohex-2-en-1-one (PubChem CID 135447546) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-hydroxy-5-phenyl-2-[(3,4,5-trimethoxyphenyl)methyliminomethyl]cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-5-phenyl-2-[(3,4,5-trimethoxyphenyl)methyliminomethyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135447546 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 3-hydroxy-5-phenyl-2-[(3,4,5-trimethoxyphenyl)methyliminomethyl]cyclohex-2-en-1-one |
| SMILES | COc1cc(C/N=C/C2=C(O)CC(c3ccccc3)CC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C23H25NO5/c1-27-21-9-15(10-22(28-2)23(21)29-3)13-24-14-18-19(25)11-17(12-20(18)26)16-7-5-4-6-8-16/h4-10,14,17,25H,11-13H2,1-3H3/b24-14+ |
| InChIKey | NKDMGJQUERLFCK-ZVHZXABRSA-N |
| XLogP | 4.24 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|