C18H32N2O2+2 — CID 7014219
[(2S)-4-(4-methoxyphenyl)butan-2-yl]-(3-morpholin-4-ium-4-ylpropyl)azanium (PubChem CID 7014219) has the molecular formula C18H32N2O2+2 and a molecular weight of 308.47 g/mol. Its IUPAC name is [(2S)-4-(4-methoxyphenyl)butan-2-yl]-(3-morpholin-4-ium-4-ylpropyl)azanium.
| Compound Name | [(2S)-4-(4-methoxyphenyl)butan-2-yl]-(3-morpholin-4-ium-4-ylpropyl)azanium |
|---|---|
| PubChem CID | 7014219 |
| Molecular Formula | C18H32N2O2+2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | [(2S)-4-(4-methoxyphenyl)butan-2-yl]-(3-morpholin-4-ium-4-ylpropyl)azanium |
| SMILES | COc1ccc(CC[C@H](C)[NH2+]CCC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C18H30N2O2/c1-16(4-5-17-6-8-18(21-2)9-7-17)19-10-3-11-20-12-14-22-15-13-20/h6-9,16,19H,3-5,10-15H2,1-2H3/p+2/t16-/m0/s1 |
| InChIKey | CFEDHAYTUYQKJQ-INIZCTEOSA-P |
| XLogP | -0.12 |
| TPSA | 39.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|