C23H33ClN2O2 — CID 110184690
2-[4-[3-(4-methoxyphenyl)propyl]piperazin-4-ium-1-yl]-1-phenylpropan-1-ol chloride (PubChem CID 110184690) has the molecular formula C23H33ClN2O2 and a molecular weight of 404.98 g/mol. Its IUPAC name is 2-[4-[3-(4-methoxyphenyl)propyl]piperazin-4-ium-1-yl]-1-phenylpropan-1-ol chloride.
| Compound Name | 2-[4-[3-(4-methoxyphenyl)propyl]piperazin-4-ium-1-yl]-1-phenylpropan-1-ol chloride |
|---|---|
| PubChem CID | 110184690 |
| Molecular Formula | C23H33ClN2O2 |
| Molecular Weight | 404.98 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2-[4-[3-(4-methoxyphenyl)propyl]piperazin-4-ium-1-yl]-1-phenylpropan-1-ol chloride |
| SMILES | COc1ccc(CCC[NH+]2CCN(C(C)C(O)c3ccccc3)CC2)cc1.[Cl-] |
| InChI | InChI=1S/C23H32N2O2.ClH/c1-19(23(26)21-8-4-3-5-9-21)25-17-15-24(16-18-25)14-6-7-20-10-12-22(27-2)13-11-20;/h3-5,8-13,19,23,26H,6-7,14-18H2,1-2H3;1H |
| InChIKey | DEMRGXNQGSRCEI-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 37.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.98 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |