About 1-(1,3-benzodioxol-5-yl)propan-2-yl-[3-(4-methoxyphenyl)propyl]azanium chloride
1-(1,3-benzodioxol-5-yl)propan-2-yl-[3-(4-methoxyphenyl)propyl]azanium chloride (PubChem CID 110185118) has the molecular formula C20H26ClNO3
and a molecular weight of 363.89 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)propan-2-yl-[3-(4-methoxyphenyl)propyl]azanium chloride.
Molecular Properties
| Compound Name | 1-(1,3-benzodioxol-5-yl)propan-2-yl-[3-(4-methoxyphenyl)propyl]azanium chloride |
| PubChem CID | 110185118 |
| Molecular Formula | C20H26ClNO3 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)propan-2-yl-[3-(4-methoxyphenyl)propyl]azanium chloride |
| SMILES | COc1ccc(CCC[NH2+]C(C)Cc2ccc3c(c2)OCO3)cc1.[Cl-] |
| InChI | InChI=1S/C20H25NO3.ClH/c1-15(12-17-7-10-19-20(13-17)24-14-23-19)21-11-3-4-16-5-8-18(22-2)9-6-16;/h5-10,13,15,21H,3-4,11-12,14H2,1-2H3;1H |
| InChIKey | JWUQZUVNVPQTJX-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-benzodioxol-5-yl)propan-2-yl-[3-(4-methoxyphenyl)propyl]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzodioxol-5-yl)propan-2-yl-[3-(4-methoxyphenyl)propyl]azanium chloride?
The IUPAC name of 1-(1,3-benzodioxol-5-yl)propan-2-yl-[3-(4-methoxyphenyl)propyl]azanium chloride (CID 110185118) is 1-(1,3-benzodioxol-5-yl)propan-2-yl-[3-(4-methoxyphenyl)propyl]azanium chloride.
What is the SMILES notation for 1-(1,3-benzodioxol-5-yl)propan-2-yl-[3-(4-methoxyphenyl)propyl]azanium chloride?
The canonical SMILES for 1-(1,3-benzodioxol-5-yl)propan-2-yl-[3-(4-methoxyphenyl)propyl]azanium chloride is COc1ccc(CCC[NH2+]C(C)Cc2ccc3c(c2)OCO3)cc1.[Cl-].
What is the InChIKey of 1-(1,3-benzodioxol-5-yl)propan-2-yl-[3-(4-methoxyphenyl)propyl]azanium chloride?
The InChIKey is JWUQZUVNVPQTJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO3.ClH/c1-15(12-17-7-10-19-20(13-17)24-14-23-19)21-11-3-4-16-5-8-18(22-2)9-6-16;/h5-10,13,15,21H,3-4,11-12,14H2,1-2H3;1H.
What are the key properties of 1-(1,3-benzodioxol-5-yl)propan-2-yl-[3-(4-methoxyphenyl)propyl]azanium chloride?
1-(1,3-benzodioxol-5-yl)propan-2-yl-[3-(4-methoxyphenyl)propyl]azanium chloride has a molecular weight of 363.89 g/mol, XLogP of -0.44, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzodioxol-5-yl)propan-2-yl-[3-(4-methoxyphenyl)propyl]azanium chloride is sourced from PubChem (CID 110185118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).