C18H18O5 — CID 23250623
1-(1,3-benzodioxol-5-yl)propan-2-yl 4-methoxybenzoate (PubChem CID 23250623) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)propan-2-yl 4-methoxybenzoate.
| Compound Name | 1-(1,3-benzodioxol-5-yl)propan-2-yl 4-methoxybenzoate |
|---|---|
| PubChem CID | 23250623 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)propan-2-yl 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC(C)Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H18O5/c1-12(9-13-3-8-16-17(10-13)22-11-21-16)23-18(19)14-4-6-15(20-2)7-5-14/h3-8,10,12H,9,11H2,1-2H3 |
| InChIKey | GBVOSRKZGDBMFY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |