C28H26O7 — CID 54556040
2-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-[(4-propan-2-yloxyphenyl)methyl]but-2-enoic acid (PubChem CID 54556040) has the molecular formula C28H26O7 and a molecular weight of 474.51 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-[(4-propan-2-yloxyphenyl)methyl]but-2-enoic acid.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-[(4-propan-2-yloxyphenyl)methyl]but-2-enoic acid |
|---|---|
| PubChem CID | 54556040 |
| Molecular Formula | C28H26O7 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-[(4-propan-2-yloxyphenyl)methyl]but-2-enoic acid |
| SMILES | COc1ccc(C(=O)C(Cc2ccc(OC(C)C)cc2)=C(C(=O)O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C28H26O7/c1-17(2)35-22-9-4-18(5-10-22)14-23(27(29)19-6-11-21(32-3)12-7-19)26(28(30)31)20-8-13-24-25(15-20)34-16-33-24/h4-13,15,17H,14,16H2,1-3H3,(H,30,31) |
| InChIKey | ZNFXYPVTLUOBFS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|