C25H18O7 — CID 10502742
(Z)-2,4-bis(1,3-benzodioxol-5-yl)-3-benzyl-4-oxobut-2-enoic acid (PubChem CID 10502742) has the molecular formula C25H18O7 and a molecular weight of 430.41 g/mol. Its IUPAC name is (Z)-2,4-bis(1,3-benzodioxol-5-yl)-3-benzyl-4-oxobut-2-enoic acid.
| Compound Name | (Z)-2,4-bis(1,3-benzodioxol-5-yl)-3-benzyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 10502742 |
| Molecular Formula | C25H18O7 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | (Z)-2,4-bis(1,3-benzodioxol-5-yl)-3-benzyl-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C(=C(/Cc1ccccc1)C(=O)c1ccc2c(c1)OCO2)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H18O7/c26-24(17-7-9-20-22(12-17)32-14-30-20)18(10-15-4-2-1-3-5-15)23(25(27)28)16-6-8-19-21(11-16)31-13-29-19/h1-9,11-12H,10,13-14H2,(H,27,28)/b23-18- |
| InChIKey | ITWUEIDDHWPPCX-NKFKGCMQSA-N |
| XLogP | 4.11 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|