C28H26O9 — CID 10696917
(Z)-2-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-[(2,4,5-trimethoxyphenyl)methyl]but-2-enoic acid (PubChem CID 10696917) has the molecular formula C28H26O9 and a molecular weight of 506.51 g/mol. Its IUPAC name is (Z)-2-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-[(2,4,5-trimethoxyphenyl)methyl]but-2-enoic acid.
| Compound Name | (Z)-2-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-[(2,4,5-trimethoxyphenyl)methyl]but-2-enoic acid |
|---|---|
| PubChem CID | 10696917 |
| Molecular Formula | C28H26O9 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | (Z)-2-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-[(2,4,5-trimethoxyphenyl)methyl]but-2-enoic acid |
| SMILES | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)cc2OC)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C28H26O9/c1-32-19-8-5-16(6-9-19)27(29)20(11-18-13-23(34-3)24(35-4)14-22(18)33-2)26(28(30)31)17-7-10-21-25(12-17)37-15-36-21/h5-10,12-14H,11,15H2,1-4H3,(H,30,31)/b26-20- |
| InChIKey | BIZKKXIKGGTLNM-QOMWVZHYSA-N |
| XLogP | 4.41 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|