C24H16Cl2O5 — CID 10503929
(Z)-2-(1,3-benzodioxol-5-yl)-3-benzyl-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid (PubChem CID 10503929) has the molecular formula C24H16Cl2O5 and a molecular weight of 455.29 g/mol. Its IUPAC name is (Z)-2-(1,3-benzodioxol-5-yl)-3-benzyl-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid.
| Compound Name | (Z)-2-(1,3-benzodioxol-5-yl)-3-benzyl-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 10503929 |
| Molecular Formula | C24H16Cl2O5 |
| Molecular Weight | 455.29 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | (Z)-2-(1,3-benzodioxol-5-yl)-3-benzyl-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C(=C(/Cc1ccccc1)C(=O)c1ccc(Cl)c(Cl)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H16Cl2O5/c25-18-8-6-16(11-19(18)26)23(27)17(10-14-4-2-1-3-5-14)22(24(28)29)15-7-9-20-21(12-15)31-13-30-20/h1-9,11-12H,10,13H2,(H,28,29)/b22-17- |
| InChIKey | VVQVSZREEKJZHF-XLNRJJMWSA-N |
| XLogP | 5.69 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.29 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|