C22H14N2O5S2 — CID 57020558
4-(1,3-benzodioxol-5-yl)-2-(2,1,3-benzothiadiazol-5-yl)-4-oxo-3-(thiophen-3-ylmethyl)but-2-enoic acid (PubChem CID 57020558) has the molecular formula C22H14N2O5S2 and a molecular weight of 450.50 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-(2,1,3-benzothiadiazol-5-yl)-4-oxo-3-(thiophen-3-ylmethyl)but-2-enoic acid.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-(2,1,3-benzothiadiazol-5-yl)-4-oxo-3-(thiophen-3-ylmethyl)but-2-enoic acid |
|---|---|
| PubChem CID | 57020558 |
| Molecular Formula | C22H14N2O5S2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-(2,1,3-benzothiadiazol-5-yl)-4-oxo-3-(thiophen-3-ylmethyl)but-2-enoic acid |
| SMILES | O=C(O)C(=C(Cc1ccsc1)C(=O)c1ccc2c(c1)OCO2)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C22H14N2O5S2/c25-21(14-2-4-18-19(9-14)29-11-28-18)15(7-12-5-6-30-10-12)20(22(26)27)13-1-3-16-17(8-13)24-31-23-16/h1-6,8-10H,7,11H2,(H,26,27) |
| InChIKey | RAERTYVQKUCBSB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|