C25H20N2O4S — CID 73412295
2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-methoxy-3-methylphenyl)methyl]-4-oxo-4-phenylbut-2-enoic acid (PubChem CID 73412295) has the molecular formula C25H20N2O4S and a molecular weight of 444.51 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-methoxy-3-methylphenyl)methyl]-4-oxo-4-phenylbut-2-enoic acid.
| Compound Name | 2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-methoxy-3-methylphenyl)methyl]-4-oxo-4-phenylbut-2-enoic acid |
|---|---|
| PubChem CID | 73412295 |
| Molecular Formula | C25H20N2O4S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-methoxy-3-methylphenyl)methyl]-4-oxo-4-phenylbut-2-enoic acid |
| SMILES | COc1ccc(CC(C(=O)c2ccccc2)=C(C(=O)O)c2ccc3nsnc3c2)cc1C |
| InChI | InChI=1S/C25H20N2O4S/c1-15-12-16(8-11-22(15)31-2)13-19(24(28)17-6-4-3-5-7-17)23(25(29)30)18-9-10-20-21(14-18)27-32-26-20/h3-12,14H,13H2,1-2H3,(H,29,30) |
| InChIKey | MEGQWLCLWRIWBY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|