C26H22N2O6S — CID 57029444
2-(2,1,3-benzothiadiazol-5-yl)-4-(3,4-dimethoxyphenyl)-3-[(3-methoxyphenyl)methyl]-4-oxobut-2-enoic acid (PubChem CID 57029444) has the molecular formula C26H22N2O6S and a molecular weight of 490.54 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-5-yl)-4-(3,4-dimethoxyphenyl)-3-[(3-methoxyphenyl)methyl]-4-oxobut-2-enoic acid.
| Compound Name | 2-(2,1,3-benzothiadiazol-5-yl)-4-(3,4-dimethoxyphenyl)-3-[(3-methoxyphenyl)methyl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 57029444 |
| Molecular Formula | C26H22N2O6S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-5-yl)-4-(3,4-dimethoxyphenyl)-3-[(3-methoxyphenyl)methyl]-4-oxobut-2-enoic acid |
| SMILES | COc1cccc(CC(C(=O)c2ccc(OC)c(OC)c2)=C(C(=O)O)c2ccc3nsnc3c2)c1 |
| InChI | InChI=1S/C26H22N2O6S/c1-32-18-6-4-5-15(11-18)12-19(25(29)17-8-10-22(33-2)23(14-17)34-3)24(26(30)31)16-7-9-20-21(13-16)28-35-27-20/h4-11,13-14H,12H2,1-3H3,(H,30,31) |
| InChIKey | LJIUWVSODQVOKE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|