C29H28N2O9S — CID 57109257
2-(2,1,3-benzothiadiazol-5-yl)-4-oxo-4-(3,4,5-trimethoxyphenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]but-2-enoic acid (PubChem CID 57109257) has the molecular formula C29H28N2O9S and a molecular weight of 580.62 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-5-yl)-4-oxo-4-(3,4,5-trimethoxyphenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]but-2-enoic acid.
| Compound Name | 2-(2,1,3-benzothiadiazol-5-yl)-4-oxo-4-(3,4,5-trimethoxyphenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]but-2-enoic acid |
|---|---|
| PubChem CID | 57109257 |
| Molecular Formula | C29H28N2O9S |
| Molecular Weight | 580.62 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-5-yl)-4-oxo-4-(3,4,5-trimethoxyphenyl)-3-[(3,4,5-trimethoxyphenyl)methyl]but-2-enoic acid |
| SMILES | COc1cc(CC(C(=O)c2cc(OC)c(OC)c(OC)c2)=C(C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C29H28N2O9S/c1-35-21-10-15(11-22(36-2)27(21)39-5)9-18(25(29(33)34)16-7-8-19-20(12-16)31-41-30-19)26(32)17-13-23(37-3)28(40-6)24(14-17)38-4/h7-8,10-14H,9H2,1-6H3,(H,33,34) |
| InChIKey | PDGXFSPRZBDLKL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 135.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.62 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|