C27H23N2NaO7S — CID 74088602
sodium 2-(2,1,3-benzothiadiazol-5-yl)-3-[(2-methoxyphenyl)methyl]-4-oxo-4-(3,4,5-trimethoxyphenyl)but-2-enoate (PubChem CID 74088602) has the molecular formula C27H23N2NaO7S and a molecular weight of 542.55 g/mol. Its IUPAC name is sodium 2-(2,1,3-benzothiadiazol-5-yl)-3-[(2-methoxyphenyl)methyl]-4-oxo-4-(3,4,5-trimethoxyphenyl)but-2-enoate.
| Compound Name | sodium 2-(2,1,3-benzothiadiazol-5-yl)-3-[(2-methoxyphenyl)methyl]-4-oxo-4-(3,4,5-trimethoxyphenyl)but-2-enoate |
|---|---|
| PubChem CID | 74088602 |
| Molecular Formula | C27H23N2NaO7S |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | sodium 2-(2,1,3-benzothiadiazol-5-yl)-3-[(2-methoxyphenyl)methyl]-4-oxo-4-(3,4,5-trimethoxyphenyl)but-2-enoate |
| SMILES | COc1ccccc1CC(C(=O)c1cc(OC)c(OC)c(OC)c1)=C(C(=O)[O-])c1ccc2nsnc2c1.[Na+] |
| InChI | InChI=1S/C27H24N2O7S.Na/c1-33-21-8-6-5-7-15(21)11-18(24(27(31)32)16-9-10-19-20(12-16)29-37-28-19)25(30)17-13-22(34-2)26(36-4)23(14-17)35-3;/h5-10,12-14H,11H2,1-4H3,(H,31,32);/q;+1/p-1 |
| InChIKey | XKMLRHACPOSBKS-UHFFFAOYSA-M |
| XLogP | 0.36 |
| TPSA | 119.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|