C25H19N2NaO5S — CID 23705869
sodium (Z)-2-(2,1,3-benzothiadiazol-5-yl)-4-(4-methoxyphenyl)-3-[(3-methoxyphenyl)methyl]-4-oxobut-2-enoate (PubChem CID 23705869) has the molecular formula C25H19N2NaO5S and a molecular weight of 482.49 g/mol. Its IUPAC name is sodium (Z)-2-(2,1,3-benzothiadiazol-5-yl)-4-(4-methoxyphenyl)-3-[(3-methoxyphenyl)methyl]-4-oxobut-2-enoate.
| Compound Name | sodium (Z)-2-(2,1,3-benzothiadiazol-5-yl)-4-(4-methoxyphenyl)-3-[(3-methoxyphenyl)methyl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 23705869 |
| Molecular Formula | C25H19N2NaO5S |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | sodium (Z)-2-(2,1,3-benzothiadiazol-5-yl)-4-(4-methoxyphenyl)-3-[(3-methoxyphenyl)methyl]-4-oxobut-2-enoate |
| SMILES | COc1ccc(C(=O)/C(Cc2cccc(OC)c2)=C(\C(=O)[O-])c2ccc3nsnc3c2)cc1.[Na+] |
| InChI | InChI=1S/C25H20N2O5S.Na/c1-31-18-9-6-16(7-10-18)24(28)20(13-15-4-3-5-19(12-15)32-2)23(25(29)30)17-8-11-21-22(14-17)27-33-26-21;/h3-12,14H,13H2,1-2H3,(H,29,30);/q;+1/p-1/b23-20-; |
| InChIKey | TVRHNEHQNVYXNK-QTXBERLJSA-M |
| XLogP | 0.34 |
| TPSA | 101.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|