C26H21N2NaO6S — CID 159379998
sodium 2-(2,1,3-benzothiadiazol-5-yl)-4-(3,4-dimethoxyphenyl)-3-[(2-methoxyphenyl)methyl]-4-oxobut-2-enoate (PubChem CID 159379998) has the molecular formula C26H21N2NaO6S and a molecular weight of 512.52 g/mol. Its IUPAC name is sodium 2-(2,1,3-benzothiadiazol-5-yl)-4-(3,4-dimethoxyphenyl)-3-[(2-methoxyphenyl)methyl]-4-oxobut-2-enoate.
| Compound Name | sodium 2-(2,1,3-benzothiadiazol-5-yl)-4-(3,4-dimethoxyphenyl)-3-[(2-methoxyphenyl)methyl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 159379998 |
| Molecular Formula | C26H21N2NaO6S |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | sodium 2-(2,1,3-benzothiadiazol-5-yl)-4-(3,4-dimethoxyphenyl)-3-[(2-methoxyphenyl)methyl]-4-oxobut-2-enoate |
| SMILES | COc1ccccc1CC(C(=O)c1ccc(OC)c(OC)c1)=C(C(=O)[O-])c1ccc2nsnc2c1.[Na+] |
| InChI | InChI=1S/C26H22N2O6S.Na/c1-32-21-7-5-4-6-15(21)12-18(25(29)17-9-11-22(33-2)23(14-17)34-3)24(26(30)31)16-8-10-19-20(13-16)28-35-27-19;/h4-11,13-14H,12H2,1-3H3,(H,30,31);/q;+1/p-1 |
| InChIKey | LKUBMLQBEYAWGD-UHFFFAOYSA-M |
| XLogP | 0.35 |
| TPSA | 110.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|