C24H17N2NaO4S — CID 74088568
sodium 2-(2,1,3-benzothiadiazol-5-yl)-3-[(2-methoxyphenyl)methyl]-4-oxo-4-phenylbut-2-enoate (PubChem CID 74088568) has the molecular formula C24H17N2NaO4S and a molecular weight of 452.47 g/mol. Its IUPAC name is sodium 2-(2,1,3-benzothiadiazol-5-yl)-3-[(2-methoxyphenyl)methyl]-4-oxo-4-phenylbut-2-enoate.
| Compound Name | sodium 2-(2,1,3-benzothiadiazol-5-yl)-3-[(2-methoxyphenyl)methyl]-4-oxo-4-phenylbut-2-enoate |
|---|---|
| PubChem CID | 74088568 |
| Molecular Formula | C24H17N2NaO4S |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | sodium 2-(2,1,3-benzothiadiazol-5-yl)-3-[(2-methoxyphenyl)methyl]-4-oxo-4-phenylbut-2-enoate |
| SMILES | COc1ccccc1CC(C(=O)c1ccccc1)=C(C(=O)[O-])c1ccc2nsnc2c1.[Na+] |
| InChI | InChI=1S/C24H18N2O4S.Na/c1-30-21-10-6-5-9-16(21)13-18(23(27)15-7-3-2-4-8-15)22(24(28)29)17-11-12-19-20(14-17)26-31-25-19;/h2-12,14H,13H2,1H3,(H,28,29);/q;+1/p-1 |
| InChIKey | GWCXBGRVADJNAT-UHFFFAOYSA-M |
| XLogP | 0.33 |
| TPSA | 92.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|