C23H17N2NaO3S2 — CID 70289466
sodium 2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-methylphenyl)methyl]-4-(4-methylthiophen-2-yl)-4-oxobut-2-enoate (PubChem CID 70289466) has the molecular formula C23H17N2NaO3S2 and a molecular weight of 456.52 g/mol. Its IUPAC name is sodium 2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-methylphenyl)methyl]-4-(4-methylthiophen-2-yl)-4-oxobut-2-enoate.
| Compound Name | sodium 2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-methylphenyl)methyl]-4-(4-methylthiophen-2-yl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 70289466 |
| Molecular Formula | C23H17N2NaO3S2 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | sodium 2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-methylphenyl)methyl]-4-(4-methylthiophen-2-yl)-4-oxobut-2-enoate |
| SMILES | Cc1ccc(CC(C(=O)c2cc(C)cs2)=C(C(=O)[O-])c2ccc3nsnc3c2)cc1.[Na+] |
| InChI | InChI=1S/C23H18N2O3S2.Na/c1-13-3-5-15(6-4-13)10-17(22(26)20-9-14(2)12-29-20)21(23(27)28)16-7-8-18-19(11-16)25-30-24-18;/h3-9,11-12H,10H2,1-2H3,(H,27,28);/q;+1/p-1 |
| InChIKey | CYCUJYVZEVMPJG-UHFFFAOYSA-M |
| XLogP | 1.00 |
| TPSA | 82.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|