C30H21N3O6S — CID 56981563
2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-nitrophenyl)methyl]-4-oxo-4-(4-phenylmethoxyphenyl)but-2-enoic acid (PubChem CID 56981563) has the molecular formula C30H21N3O6S and a molecular weight of 551.58 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-nitrophenyl)methyl]-4-oxo-4-(4-phenylmethoxyphenyl)but-2-enoic acid.
| Compound Name | 2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-nitrophenyl)methyl]-4-oxo-4-(4-phenylmethoxyphenyl)but-2-enoic acid |
|---|---|
| PubChem CID | 56981563 |
| Molecular Formula | C30H21N3O6S |
| Molecular Weight | 551.58 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-nitrophenyl)methyl]-4-oxo-4-(4-phenylmethoxyphenyl)but-2-enoic acid |
| SMILES | O=C(O)C(=C(Cc1ccc([N+](=O)[O-])cc1)C(=O)c1ccc(OCc2ccccc2)cc1)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C30H21N3O6S/c34-29(21-8-13-24(14-9-21)39-18-20-4-2-1-3-5-20)25(16-19-6-11-23(12-7-19)33(37)38)28(30(35)36)22-10-15-26-27(17-22)32-40-31-26/h1-15,17H,16,18H2,(H,35,36) |
| InChIKey | ZADLCQBAWVNUPO-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.58 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|