C31H24N2O6 — CID 57106647
2-(2,1,3-benzoxadiazol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-[(4-phenylmethoxyphenyl)methyl]but-2-enoic acid (PubChem CID 57106647) has the molecular formula C31H24N2O6 and a molecular weight of 520.54 g/mol. Its IUPAC name is 2-(2,1,3-benzoxadiazol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-[(4-phenylmethoxyphenyl)methyl]but-2-enoic acid.
| Compound Name | 2-(2,1,3-benzoxadiazol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-[(4-phenylmethoxyphenyl)methyl]but-2-enoic acid |
|---|---|
| PubChem CID | 57106647 |
| Molecular Formula | C31H24N2O6 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 2-(2,1,3-benzoxadiazol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-[(4-phenylmethoxyphenyl)methyl]but-2-enoic acid |
| SMILES | COc1ccc(C(=O)C(Cc2ccc(OCc3ccccc3)cc2)=C(C(=O)O)c2ccc3nonc3c2)cc1 |
| InChI | InChI=1S/C31H24N2O6/c1-37-24-14-9-22(10-15-24)30(34)26(29(31(35)36)23-11-16-27-28(18-23)33-39-32-27)17-20-7-12-25(13-8-20)38-19-21-5-3-2-4-6-21/h2-16,18H,17,19H2,1H3,(H,35,36) |
| InChIKey | FKHSQNPHDNJSRY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|