C24H17N3O7 — CID 57196459
2-(2,1,3-benzoxadiazol-5-yl)-4-(4-methoxyphenyl)-3-[(4-nitrophenyl)methyl]-4-oxobut-2-enoic acid (PubChem CID 57196459) has the molecular formula C24H17N3O7 and a molecular weight of 459.41 g/mol. Its IUPAC name is 2-(2,1,3-benzoxadiazol-5-yl)-4-(4-methoxyphenyl)-3-[(4-nitrophenyl)methyl]-4-oxobut-2-enoic acid.
| Compound Name | 2-(2,1,3-benzoxadiazol-5-yl)-4-(4-methoxyphenyl)-3-[(4-nitrophenyl)methyl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 57196459 |
| Molecular Formula | C24H17N3O7 |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 2-(2,1,3-benzoxadiazol-5-yl)-4-(4-methoxyphenyl)-3-[(4-nitrophenyl)methyl]-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(C(=O)C(Cc2ccc([N+](=O)[O-])cc2)=C(C(=O)O)c2ccc3nonc3c2)cc1 |
| InChI | InChI=1S/C24H17N3O7/c1-33-18-9-4-15(5-10-18)23(28)19(12-14-2-7-17(8-3-14)27(31)32)22(24(29)30)16-6-11-20-21(13-16)26-34-25-20/h2-11,13H,12H2,1H3,(H,29,30) |
| InChIKey | LPGZHSQOKIAQRN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|