C22H16N2O4S2 — CID 74953225
2-(2,1,3-benzothiadiazol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-(thiophen-2-ylmethyl)but-2-enoic acid (PubChem CID 74953225) has the molecular formula C22H16N2O4S2 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-(thiophen-2-ylmethyl)but-2-enoic acid.
| Compound Name | 2-(2,1,3-benzothiadiazol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-(thiophen-2-ylmethyl)but-2-enoic acid |
|---|---|
| PubChem CID | 74953225 |
| Molecular Formula | C22H16N2O4S2 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-(thiophen-2-ylmethyl)but-2-enoic acid |
| SMILES | COc1ccc(C(=O)C(Cc2cccs2)=C(C(=O)O)c2ccc3nsnc3c2)cc1 |
| InChI | InChI=1S/C22H16N2O4S2/c1-28-15-7-4-13(5-8-15)21(25)17(12-16-3-2-10-29-16)20(22(26)27)14-6-9-18-19(11-14)24-30-23-18/h2-11H,12H2,1H3,(H,26,27) |
| InChIKey | LTVRFAGIJIXVTA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|