C24H18N2O5S — CID 57199391
2-(2,1,3-benzothiadiazol-5-yl)-3,4-bis(4-methoxyphenyl)-4-oxobut-2-enoic acid (PubChem CID 57199391) has the molecular formula C24H18N2O5S and a molecular weight of 446.48 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-5-yl)-3,4-bis(4-methoxyphenyl)-4-oxobut-2-enoic acid.
| Compound Name | 2-(2,1,3-benzothiadiazol-5-yl)-3,4-bis(4-methoxyphenyl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 57199391 |
| Molecular Formula | C24H18N2O5S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-5-yl)-3,4-bis(4-methoxyphenyl)-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(C(=O)C(=C(C(=O)O)c2ccc3nsnc3c2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H18N2O5S/c1-30-17-8-3-14(4-9-17)21(23(27)15-5-10-18(31-2)11-6-15)22(24(28)29)16-7-12-19-20(13-16)26-32-25-19/h3-13H,1-2H3,(H,28,29) |
| InChIKey | NINSAFMBJJIVQK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|