C25H21N3O6S — CID 57288338
2-(2,1,3-benzothiadiazol-5-yl)-4-(2,5-dimethoxyphenyl)-3-[(2-methoxy-4-pyridinyl)methyl]-4-oxobut-2-enoic acid (PubChem CID 57288338) has the molecular formula C25H21N3O6S and a molecular weight of 491.53 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-5-yl)-4-(2,5-dimethoxyphenyl)-3-[(2-methoxy-4-pyridinyl)methyl]-4-oxobut-2-enoic acid.
| Compound Name | 2-(2,1,3-benzothiadiazol-5-yl)-4-(2,5-dimethoxyphenyl)-3-[(2-methoxy-4-pyridinyl)methyl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 57288338 |
| Molecular Formula | C25H21N3O6S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-5-yl)-4-(2,5-dimethoxyphenyl)-3-[(2-methoxy-4-pyridinyl)methyl]-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(OC)c(C(=O)C(Cc2ccnc(OC)c2)=C(C(=O)O)c2ccc3nsnc3c2)c1 |
| InChI | InChI=1S/C25H21N3O6S/c1-32-16-5-7-21(33-2)17(13-16)24(29)18(10-14-8-9-26-22(11-14)34-3)23(25(30)31)15-4-6-19-20(12-15)28-35-27-19/h4-9,11-13H,10H2,1-3H3,(H,30,31) |
| InChIKey | DWDXCNMYXHPDJM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 120.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|