C31H24N2O5S — CID 56992215
2-(2,1,3-benzothiadiazol-5-yl)-3-[(3-methoxyphenyl)methyl]-4-oxo-4-(4-phenylmethoxyphenyl)but-2-enoic acid (PubChem CID 56992215) has the molecular formula C31H24N2O5S and a molecular weight of 536.61 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-5-yl)-3-[(3-methoxyphenyl)methyl]-4-oxo-4-(4-phenylmethoxyphenyl)but-2-enoic acid.
| Compound Name | 2-(2,1,3-benzothiadiazol-5-yl)-3-[(3-methoxyphenyl)methyl]-4-oxo-4-(4-phenylmethoxyphenyl)but-2-enoic acid |
|---|---|
| PubChem CID | 56992215 |
| Molecular Formula | C31H24N2O5S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-5-yl)-3-[(3-methoxyphenyl)methyl]-4-oxo-4-(4-phenylmethoxyphenyl)but-2-enoic acid |
| SMILES | COc1cccc(CC(C(=O)c2ccc(OCc3ccccc3)cc2)=C(C(=O)O)c2ccc3nsnc3c2)c1 |
| InChI | InChI=1S/C31H24N2O5S/c1-37-25-9-5-8-21(16-25)17-26(29(31(35)36)23-12-15-27-28(18-23)33-39-32-27)30(34)22-10-13-24(14-11-22)38-19-20-6-3-2-4-7-20/h2-16,18H,17,19H2,1H3,(H,35,36) |
| InChIKey | GZFPHFFUTFVAMM-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|