C26H18N4O4S — CID 57268203
2-(2,1,3-benzothiadiazol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-(quinoxalin-6-ylmethyl)but-2-enoic acid (PubChem CID 57268203) has the molecular formula C26H18N4O4S and a molecular weight of 482.52 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-(quinoxalin-6-ylmethyl)but-2-enoic acid.
| Compound Name | 2-(2,1,3-benzothiadiazol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-(quinoxalin-6-ylmethyl)but-2-enoic acid |
|---|---|
| PubChem CID | 57268203 |
| Molecular Formula | C26H18N4O4S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-(quinoxalin-6-ylmethyl)but-2-enoic acid |
| SMILES | COc1ccc(C(=O)C(Cc2ccc3nccnc3c2)=C(C(=O)O)c2ccc3nsnc3c2)cc1 |
| InChI | InChI=1S/C26H18N4O4S/c1-34-18-6-3-16(4-7-18)25(31)19(12-15-2-8-20-22(13-15)28-11-10-27-20)24(26(32)33)17-5-9-21-23(14-17)30-35-29-21/h2-11,13-14H,12H2,1H3,(H,32,33) |
| InChIKey | XQIJSOXALUWNPU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 115.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|