C25H22O5 — CID 10763625
(Z)-3-benzyl-2-(3-methoxyphenyl)-4-(4-methoxyphenyl)-4-oxobut-2-enoic acid (PubChem CID 10763625) has the molecular formula C25H22O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is (Z)-3-benzyl-2-(3-methoxyphenyl)-4-(4-methoxyphenyl)-4-oxobut-2-enoic acid.
| Compound Name | (Z)-3-benzyl-2-(3-methoxyphenyl)-4-(4-methoxyphenyl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 10763625 |
| Molecular Formula | C25H22O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (Z)-3-benzyl-2-(3-methoxyphenyl)-4-(4-methoxyphenyl)-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C25H22O5/c1-29-20-13-11-18(12-14-20)24(26)22(15-17-7-4-3-5-8-17)23(25(27)28)19-9-6-10-21(16-19)30-2/h3-14,16H,15H2,1-2H3,(H,27,28)/b23-22- |
| InChIKey | BWXHXPRFGDLFDG-FCQUAONHSA-N |
| XLogP | 4.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|