C32H26N3NaO4S — CID 23705841
sodium (E)-2-(2,1,3-benzothiadiazol-5-yl)-3-[[4-(dimethylamino)phenyl]methyl]-4-oxo-4-(4-phenylmethoxyphenyl)but-2-enoate (PubChem CID 23705841) has the molecular formula C32H26N3NaO4S and a molecular weight of 571.63 g/mol. Its IUPAC name is sodium (E)-2-(2,1,3-benzothiadiazol-5-yl)-3-[[4-(dimethylamino)phenyl]methyl]-4-oxo-4-(4-phenylmethoxyphenyl)but-2-enoate.
| Compound Name | sodium (E)-2-(2,1,3-benzothiadiazol-5-yl)-3-[[4-(dimethylamino)phenyl]methyl]-4-oxo-4-(4-phenylmethoxyphenyl)but-2-enoate |
|---|---|
| PubChem CID | 23705841 |
| Molecular Formula | C32H26N3NaO4S |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | sodium (E)-2-(2,1,3-benzothiadiazol-5-yl)-3-[[4-(dimethylamino)phenyl]methyl]-4-oxo-4-(4-phenylmethoxyphenyl)but-2-enoate |
| SMILES | CN(C)c1ccc(C/C(C(=O)c2ccc(OCc3ccccc3)cc2)=C(\C(=O)[O-])c2ccc3nsnc3c2)cc1.[Na+] |
| InChI | InChI=1S/C32H27N3O4S.Na/c1-35(2)25-13-8-21(9-14-25)18-27(30(32(37)38)24-12-17-28-29(19-24)34-40-33-28)31(36)23-10-15-26(16-11-23)39-20-22-6-4-3-5-7-22;/h3-17,19H,18,20H2,1-2H3,(H,37,38);/q;+1/p-1/b30-27+; |
| InChIKey | TYRNXAXHNDMFQY-CXTQECRMSA-M |
| XLogP | 1.97 |
| TPSA | 95.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|