C25H17N2NaO6S — CID 23705837
sodium (E)-4-(1,3-benzodioxol-5-yl)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(3-methoxyphenyl)methyl]-4-oxobut-2-enoate (PubChem CID 23705837) has the molecular formula C25H17N2NaO6S and a molecular weight of 496.48 g/mol. Its IUPAC name is sodium (E)-4-(1,3-benzodioxol-5-yl)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(3-methoxyphenyl)methyl]-4-oxobut-2-enoate.
| Compound Name | sodium (E)-4-(1,3-benzodioxol-5-yl)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(3-methoxyphenyl)methyl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 23705837 |
| Molecular Formula | C25H17N2NaO6S |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | sodium (E)-4-(1,3-benzodioxol-5-yl)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(3-methoxyphenyl)methyl]-4-oxobut-2-enoate |
| SMILES | COc1cccc(C/C(C(=O)c2ccc3c(c2)OCO3)=C(\C(=O)[O-])c2ccc3nsnc3c2)c1.[Na+] |
| InChI | InChI=1S/C25H18N2O6S.Na/c1-31-17-4-2-3-14(9-17)10-18(24(28)16-6-8-21-22(12-16)33-13-32-21)23(25(29)30)15-5-7-19-20(11-15)27-34-26-19;/h2-9,11-12H,10,13H2,1H3,(H,29,30);/q;+1/p-1/b23-18+; |
| InChIKey | FXXGWAMDCMDVNP-XHMOQMQQSA-M |
| XLogP | 0.06 |
| TPSA | 110.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|