C24H18NNaO6 — CID 139758202
sodium (Z)-2-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-(pyridin-3-ylmethyl)but-2-enoate (PubChem CID 139758202) has the molecular formula C24H18NNaO6 and a molecular weight of 439.40 g/mol. Its IUPAC name is sodium (Z)-2-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-(pyridin-3-ylmethyl)but-2-enoate.
| Compound Name | sodium (Z)-2-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-(pyridin-3-ylmethyl)but-2-enoate |
|---|---|
| PubChem CID | 139758202 |
| Molecular Formula | C24H18NNaO6 |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | sodium (Z)-2-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)-4-oxo-3-(pyridin-3-ylmethyl)but-2-enoate |
| SMILES | COc1ccc(C(=O)/C(Cc2cccnc2)=C(\C(=O)[O-])c2ccc3c(c2)OCO3)cc1.[Na+] |
| InChI | InChI=1S/C24H19NO6.Na/c1-29-18-7-4-16(5-8-18)23(26)19(11-15-3-2-10-25-13-15)22(24(27)28)17-6-9-20-21(12-17)31-14-30-20;/h2-10,12-13H,11,14H2,1H3,(H,27,28);/q;+1/p-1/b22-19-; |
| InChIKey | KCIWPFZTBMQVHC-GXTSIBQPSA-M |
| XLogP | -0.55 |
| TPSA | 97.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|