C25H18N2O6S — CID 56995470
4-(1,3-benzodioxol-5-yl)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(2-methoxyphenyl)methyl]-4-oxobut-2-enoic acid (PubChem CID 56995470) has the molecular formula C25H18N2O6S and a molecular weight of 474.49 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(2-methoxyphenyl)methyl]-4-oxobut-2-enoic acid.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(2-methoxyphenyl)methyl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 56995470 |
| Molecular Formula | C25H18N2O6S |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(2-methoxyphenyl)methyl]-4-oxobut-2-enoic acid |
| SMILES | COc1ccccc1CC(C(=O)c1ccc2c(c1)OCO2)=C(C(=O)O)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C25H18N2O6S/c1-31-20-5-3-2-4-14(20)10-17(24(28)16-7-9-21-22(12-16)33-13-32-21)23(25(29)30)15-6-8-18-19(11-15)27-34-26-18/h2-9,11-12H,10,13H2,1H3,(H,29,30) |
| InChIKey | RRMYAFJNFYFQNJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|