C25H15N3O5S — CID 57153525
4-(1,3-benzodioxol-5-yl)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-cyanophenyl)methyl]-4-oxobut-2-enoic acid (PubChem CID 57153525) has the molecular formula C25H15N3O5S and a molecular weight of 469.48 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-cyanophenyl)methyl]-4-oxobut-2-enoic acid.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-cyanophenyl)methyl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 57153525 |
| Molecular Formula | C25H15N3O5S |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-(2,1,3-benzothiadiazol-5-yl)-3-[(4-cyanophenyl)methyl]-4-oxobut-2-enoic acid |
| SMILES | N#Cc1ccc(CC(C(=O)c2ccc3c(c2)OCO3)=C(C(=O)O)c2ccc3nsnc3c2)cc1 |
| InChI | InChI=1S/C25H15N3O5S/c26-12-15-3-1-14(2-4-15)9-18(24(29)17-6-8-21-22(11-17)33-13-32-21)23(25(30)31)16-5-7-19-20(10-16)28-34-27-19/h1-8,10-11H,9,13H2,(H,30,31) |
| InChIKey | ARPOPMGKVQHTLJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 122.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|