C22H15N3O5S2 — CID 70288331
2-(2,1,3-benzothiadiazol-5-yl)-4-(4-methylthiophen-2-yl)-3-[(4-nitrophenyl)methyl]-4-oxobut-2-enoic acid (PubChem CID 70288331) has the molecular formula C22H15N3O5S2 and a molecular weight of 465.51 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-5-yl)-4-(4-methylthiophen-2-yl)-3-[(4-nitrophenyl)methyl]-4-oxobut-2-enoic acid.
| Compound Name | 2-(2,1,3-benzothiadiazol-5-yl)-4-(4-methylthiophen-2-yl)-3-[(4-nitrophenyl)methyl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 70288331 |
| Molecular Formula | C22H15N3O5S2 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-5-yl)-4-(4-methylthiophen-2-yl)-3-[(4-nitrophenyl)methyl]-4-oxobut-2-enoic acid |
| SMILES | Cc1csc(C(=O)C(Cc2ccc([N+](=O)[O-])cc2)=C(C(=O)O)c2ccc3nsnc3c2)c1 |
| InChI | InChI=1S/C22H15N3O5S2/c1-12-8-19(31-11-12)21(26)16(9-13-2-5-15(6-3-13)25(29)30)20(22(27)28)14-4-7-17-18(10-14)24-32-23-17/h2-8,10-11H,9H2,1H3,(H,27,28) |
| InChIKey | WOZKWLZVAVRILJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|