C24H20N2O7S — CID 154071371
2-(2,1,3-benzothiadiazol-5-yl)-3-(furan-2-ylmethyl)-4-oxo-4-(3,4,5-trimethoxyphenyl)but-2-enoic acid (PubChem CID 154071371) has the molecular formula C24H20N2O7S and a molecular weight of 480.50 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-5-yl)-3-(furan-2-ylmethyl)-4-oxo-4-(3,4,5-trimethoxyphenyl)but-2-enoic acid.
| Compound Name | 2-(2,1,3-benzothiadiazol-5-yl)-3-(furan-2-ylmethyl)-4-oxo-4-(3,4,5-trimethoxyphenyl)but-2-enoic acid |
|---|---|
| PubChem CID | 154071371 |
| Molecular Formula | C24H20N2O7S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-5-yl)-3-(furan-2-ylmethyl)-4-oxo-4-(3,4,5-trimethoxyphenyl)but-2-enoic acid |
| SMILES | COc1cc(C(=O)C(Cc2ccco2)=C(C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H20N2O7S/c1-30-19-10-14(11-20(31-2)23(19)32-3)22(27)16(12-15-5-4-8-33-15)21(24(28)29)13-6-7-17-18(9-13)26-34-25-17/h4-11H,12H2,1-3H3,(H,28,29) |
| InChIKey | IUKQIPWUTWMEDO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|