C17H10N2O7 — CID 57325007
2-(1,3-benzodioxol-5-yl)-3-(2,1,3-benzoxadiazol-5-yl)but-2-enedioic acid (PubChem CID 57325007) has the molecular formula C17H10N2O7 and a molecular weight of 354.27 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-3-(2,1,3-benzoxadiazol-5-yl)but-2-enedioic acid.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-3-(2,1,3-benzoxadiazol-5-yl)but-2-enedioic acid |
|---|---|
| PubChem CID | 57325007 |
| Molecular Formula | C17H10N2O7 |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3-(2,1,3-benzoxadiazol-5-yl)but-2-enedioic acid |
| SMILES | O=C(O)C(=C(C(=O)O)c1ccc2nonc2c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H10N2O7/c20-16(21)14(8-1-3-10-11(5-8)19-26-18-10)15(17(22)23)9-2-4-12-13(6-9)25-7-24-12/h1-6H,7H2,(H,20,21)(H,22,23) |
| InChIKey | LHZVYYBFBTXXON-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|