C18H18O6 — CID 82140683
3-(1,3-benzodioxol-5-yl)-2-(2,4-dimethoxyphenyl)propanoic acid (PubChem CID 82140683) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-2-(2,4-dimethoxyphenyl)propanoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-2-(2,4-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 82140683 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-2-(2,4-dimethoxyphenyl)propanoic acid |
| SMILES | COc1ccc(C(Cc2ccc3c(c2)OCO3)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C18H18O6/c1-21-12-4-5-13(16(9-12)22-2)14(18(19)20)7-11-3-6-15-17(8-11)24-10-23-15/h3-6,8-9,14H,7,10H2,1-2H3,(H,19,20) |
| InChIKey | IRBQMDRPFJZWBL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |