C12H18N4O3S — CID 7530411
5-(3-morpholin-4-ylpropyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7530411) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is 5-(3-morpholin-4-ylpropyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-(3-morpholin-4-ylpropyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7530411 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 5-(3-morpholin-4-ylpropyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1/C=N/CCCN1CCOCC1 |
| InChI | InChI=1S/C12H18N4O3S/c17-10-9(11(18)15-12(20)14-10)8-13-2-1-3-16-4-6-19-7-5-16/h8-9H,1-7H2,(H2,14,15,17,18,20)/b13-8+ |
| InChIKey | ZYHGXDPHKYPWKY-MDWZMJQESA-N |
| XLogP | -1.07 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|