C20H24N2O2S4 — CID 54407226
4-(butylsulfanylmethylidene)-2,6-bis(2-thiophen-2-ylethyl)-1,2,6-thiadiazinane-3,5-dione (PubChem CID 54407226) has the molecular formula C20H24N2O2S4 and a molecular weight of 452.69 g/mol. Its IUPAC name is 4-(butylsulfanylmethylidene)-2,6-bis(2-thiophen-2-ylethyl)-1,2,6-thiadiazinane-3,5-dione.
| Compound Name | 4-(butylsulfanylmethylidene)-2,6-bis(2-thiophen-2-ylethyl)-1,2,6-thiadiazinane-3,5-dione |
|---|---|
| PubChem CID | 54407226 |
| Molecular Formula | C20H24N2O2S4 |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 4-(butylsulfanylmethylidene)-2,6-bis(2-thiophen-2-ylethyl)-1,2,6-thiadiazinane-3,5-dione |
| SMILES | CCCCSC=C1C(=O)N(CCc2cccs2)SN(CCc2cccs2)C1=O |
| InChI | InChI=1S/C20H24N2O2S4/c1-2-3-12-25-15-18-19(23)21(10-8-16-6-4-13-26-16)28-22(20(18)24)11-9-17-7-5-14-27-17/h4-7,13-15H,2-3,8-12H2,1H3 |
| InChIKey | VROPTGKHOYJSNM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|