C9H11N3OS — CID 86797131
4-methyl-2-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-one (PubChem CID 86797131) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is 4-methyl-2-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-one.
| Compound Name | 4-methyl-2-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 86797131 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 4-methyl-2-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-one |
| SMILES | Cn1cnn(CCc2cccs2)c1=O |
| InChI | InChI=1S/C9H11N3OS/c1-11-7-10-12(9(11)13)5-4-8-3-2-6-14-8/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | XPTUXMWFUBEFMB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |