C13H18N4OS — CID 103223605
5-[2-(methylamino)ethylamino]-2-(2-thiophen-2-ylethyl)pyridazin-3-one (PubChem CID 103223605) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 5-[2-(methylamino)ethylamino]-2-(2-thiophen-2-ylethyl)pyridazin-3-one.
| Compound Name | 5-[2-(methylamino)ethylamino]-2-(2-thiophen-2-ylethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 103223605 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 5-[2-(methylamino)ethylamino]-2-(2-thiophen-2-ylethyl)pyridazin-3-one |
| SMILES | CNCCNc1cnn(CCc2cccs2)c(=O)c1 |
| InChI | InChI=1S/C13H18N4OS/c1-14-5-6-15-11-9-13(18)17(16-10-11)7-4-12-3-2-8-19-12/h2-3,8-10,14-15H,4-7H2,1H3 |
| InChIKey | MFMJMBBQWZHUIJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|