C10H8Cl2N2OS — CID 114583003
5,6-dichloro-3-(2-thiophen-2-ylethyl)pyrimidin-4-one (PubChem CID 114583003) has the molecular formula C10H8Cl2N2OS and a molecular weight of 275.16 g/mol. Its IUPAC name is 5,6-dichloro-3-(2-thiophen-2-ylethyl)pyrimidin-4-one.
| Compound Name | 5,6-dichloro-3-(2-thiophen-2-ylethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 114583003 |
| Molecular Formula | C10H8Cl2N2OS |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 5,6-dichloro-3-(2-thiophen-2-ylethyl)pyrimidin-4-one |
| SMILES | O=c1c(Cl)c(Cl)ncn1CCc1cccs1 |
| InChI | InChI=1S/C10H8Cl2N2OS/c11-8-9(12)13-6-14(10(8)15)4-3-7-2-1-5-16-7/h1-2,5-6H,3-4H2 |
| InChIKey | VPVWSTUHTDFLQO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |