C11H14N2OS2 — CID 94691207
2-[1-(2-thiophen-2-ylethyl)imidazol-2-yl]sulfanylethanol (PubChem CID 94691207) has the molecular formula C11H14N2OS2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-[1-(2-thiophen-2-ylethyl)imidazol-2-yl]sulfanylethanol.
| Compound Name | 2-[1-(2-thiophen-2-ylethyl)imidazol-2-yl]sulfanylethanol |
|---|---|
| PubChem CID | 94691207 |
| Molecular Formula | C11H14N2OS2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-[1-(2-thiophen-2-ylethyl)imidazol-2-yl]sulfanylethanol |
| SMILES | OCCSc1nccn1CCc1cccs1 |
| InChI | InChI=1S/C11H14N2OS2/c14-7-9-16-11-12-4-6-13(11)5-3-10-2-1-8-15-10/h1-2,4,6,8,14H,3,5,7,9H2 |
| InChIKey | FVUQFMNKRPNZNI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |